(E)-tridec-4-enyl acetate |
Last updated: 24/05/2024
|
|
(Also known as: Lycopersilure; Keiferia lycopersicella pheromone; Tomato pinworm pheromone; AI3-34338; Straight Chain Lepidopteran Pheromone; SCLP; Tomato pinworm pheromone) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A volatile substance that is classed as a Straight Chain Lepidopteran Pheromone (SCLP) and used as an insect attractant for Lepidopteran species |
|
Tomato pinworm (Keiferia lycopersicella) |
|
Tomatoes; Aubergines |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Italy/France |
|
31/08/2023 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric |
|
C₁₅H₂₈O₂ |
|
CCCCCCCCC=CCCCOC(=O)C |
|
CCCCCCCC/C=C/CCCOC(=O)C |
|
DUCVQKMNGSZPAV-ZHACJKMWSA-N |
|
InChI=1S/C15H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-15(2)16/h10-11H,3-9,12-14H2,1-2H3/b11-10+ |
|
Yes |
|
Insecticide, Semiochemical |
|
Pheromone |
|
- |
|
- |
|
Natural |
|
Functions as an insect attractant - mating disrupter |
|
Originally isolated from the tomato pinworm (Keiferia lycopersicella) |
|
Manufactered for commerical crop protection applications |
|
Crop protection |
|
Tomato pinworm (Keiferia lycopersicella) |
|
Tomatoes; Aubergines |
|
Suitable for use in all farming systems where approved for use in that country |
|
72269-48-8 |
|
- |
|
- |
|
121902 |
|
- |
|
240.38 |
|
- |
|
(E)-4-tridecen-1-yl acetate |
|
(E)-tridec-4-enyl acetate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Solid |
|
|
|
|
Wing Trap Kit for Tomato pinworm, Keiferia lycopersicella |
Arbico Organics |
|
Usually supplied in slow-release forumations for use within pheromone dispensers. Some sprayable formulations are also available. |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
107 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected. |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected. |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
Not expected to produce harmful effects in humans |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
(E)-tridec-4-enyl acetate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
24/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |