Methyl anthranilate |
Last updated: 22/08/2024
|
|
(Also known as: nevoli oil; methyl aminobenzoate; anthranilic acid methyl ester; MA; neroli oil) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Naturally occurring substance extracted from plants including grapes, neroli, oranges and ylang ylang. It is also used as a bird repellent food and ornamental crops as well as on golf-courses |
|
Birds |
|
Fruit ripening on trees and bushes; Maize; Rice; Fruit; Sports greens |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₈H₉NO₂ |
|
COC(=O)C1=CC=CC=C1N |
|
No data |
|
VAMXMNNIEUEQDV-UHFFFAOYSA-N |
|
InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
methyl anthranilate |
- |
|
|
Semiochemical |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Physical repellent action based on odour and taste |
|
Extracted from a wide range of plants including grapes, neroli, wisteria, oranges and ylang ylang. It is also secreted by the musk glands of foxes and dogs |
|
- |
|
Crop protection; leisure - golf courses |
|
Birds |
|
Fruit ripening on trees and bushes; Maize; Rice; Fruit; Sports greens |
|
- |
|
134-20-3 |
|
205-132-4 |
|
- |
|
128725 |
|
8635 |
|
151.17 |
|
- |
|
methyl 2-aminobenzoate |
|
methyl anthranilate |
|
Has GRAS approval under US 21 CFR 182.60 |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Clear to pale yellow liquid with fruity smell |
|
|
|
|
Methyl Anthranilate |
Lansdowne Aromatics |
Bird Shield Repellent Concentrate |
BSRC |
EcoBird 4.0 |
Roth Chemical Company, USA |
|
- |
|
|
|
|
|
2850 |
|
High |
|
- |
- |
- |
|
24 |
|
- |
|
256 |
|
- |
|
- |
- |
- |
|
110 |
|
- |
|
|
7.59 X 1001 |
Calculated |
- |
|
1.88 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.17 |
|
- |
|
2.23 |
|
- |
Strong acid |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
2910 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2036 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
25 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
23.19 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
2910 |
Rat |
Low |
|
5000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
Mainly excreted via the urine |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
May cause asthmatic response, some ancedotal evidence of respiratory tract damage May cause discomfort if swallowed |
|
|
|
Combustable Not explosive or corrosive |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
methyl anthranilate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |