Mepiquat |
Last updated: 24/07/2024
|
|
(Also known as: mepiquat ion) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A plant growth regulator used to reduce vegetative growth. It is usually used as the chloride salt. |
|
Growth |
|
Cereals including wheat, oats, barley, rye, triticale; Grass; Onions; Leeks; Garlic |
|
- |
|
- |
|
Current |
|
1980, introduced |
|
- |
|
Approved |
|
28/02/2029 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Finland/Estonia |
|
15/10/2025 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
  |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
✓ |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₇H₁₆N |
|
C[N+]1(CCCCC1)C |
|
- |
|
NNCAWEWCFVZOGF-UHFFFAOYSA-N |
|
InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
|
Yes |
|
Plant Growth Regulator, Herbicide |
|
Quarternary ammonium PGR |
|
- |
|
- |
|
Synthetic |
|
Gibberellin biosynthesis inhibitor |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
15302-91-7 |
|
604-881-8 |
|
440 |
|
- |
|
18743 |
|
No data found |
|
114.21 |
|
1,1-dimethylpiperidin-1-ium |
|
1,1-dimethylpiperidinium |
|
1,1-dimethylpiperidinium |
|
- |
|
- |
|
Not known |
|
Not known |
|
Not applicable |
|
Not applicable |
|
- |
|
Solid |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.82 X 10-04 |
Calculated |
- |
|
-3.55 |
as acid |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
3.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 2.8-4.3, 2 field crops, whole plant matrix, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
1490 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
> 155 |
Rat Reproductive NOAEL as chloride variant |
Moderate |
|
> 2000 |
Colinus virginianus as chloride variant |
Low |
|
- |
- |
- |
|
> 100.7 |
Coturnix japonica as chloride variant NOAEL |
Moderate |
|
> 3195 |
Eisenia foetida as chloride variant |
Low |
|
31.25 |
Eisenia foetida as chloride variant |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
as chloride variant |
Low |
|
> 107.4 |
as chloride variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
- |
- |
- |
|
68.5 |
Daphnia magna as chloride variant |
Moderate |
|
12.5 |
Daphnia magna as chloride variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
15.4 |
Lemna gibba as chloride variant |
Low |
|
> 44.8 |
Aphanizomenon flos-aquae as chloride variant |
Low |
|
14.4 |
Aphanizomenon flos-aquae as chloride variant |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
1490 |
Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.2 |
|
- |
|
0.3 |
|
- |
|
- |
- |
- |
|
0.3 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risk from dietary exposure Risk assessment indicates ARfD would not normally be exceded |
|
Risk of exposure acceptable under label recommendations for use for personal protection clothing and equipment |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
Moderately toxic |
|
|
|
Prevent generation of mists |
|
Health: H302 Environment: H412 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
mepiquat |
|
mepiquat |
|
Mepiquat |
|
mepiquat |
|
mepiquat |
|
mepicuat |
|
- |
|
mepikwatu |
|
mepikvat |
|
- |
|
- |
|
- |
Record last updated: |
24/07/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |