Fenobucarb (Ref: BAY 41367C) |
Last updated: 22/08/2024
|
|
(Also known as: BRN 2052332; BPMC) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Used to control a range of biting and sucking insects in rice and other crops |
|
Leaf hoppers, Leaf rollers, Thrips, Stem borers |
|
Rice; Cotton |
|
- |
|
- |
|
- |
|
1968, introduced |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Fenobucarb is a chiral molecule. The technical material is an isomeric mixture. |
|
C₁₂H₁₇NO₂ |
|
CCC(C)C1=CC=CC=C1OC(=O)NC |
|
- |
|
DIRFUJHNVNOBMY-UHFFFAOYSA-N |
|
InChI=1S/C12H17NO2/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
|
Yes |
|
Insecticide |
|
Carbamate insecticide |
|
- |
|
- |
|
Synthetic |
|
Contact acting with long residual effects. Acetylcholinesterase (AChE) inhibitor. |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
3766-81-2 |
|
223-188-8 |
|
390 |
|
- |
|
19588 |
|
006-085-00-0 |
|
207.27 |
|
rac-2-[(2R)-butan-2-yl]phenyl methylcarbamate |
|
(RS)-2-sec-butylphenyl methylcarbamate |
|
2-(1-methylpropyl)phenyl methylcarbamate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
Nephotettix cincticeps, Sogatella furcifera |
|
Oily yellow liquid which may solidify at lower temperatures |
|
|
|
|
- |
- |
|
Available in a variety of formulations including emulsifiable concentrates, dusts, micro granules and ULV liquids. |
|
|
|
|
|
420.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
31.5 |
|
- |
|
Decomposes before boiling |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
142 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
6.03 X 1002 |
Calculated |
- |
|
2.78 |
|
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.04 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
48 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
18.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ 14-23 Days in upland soil, paddy fields 7-9 days |
|
|
- |
- |
- |
|
- |
|
|
6.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 2.2-10.9 days, 2 field crops, various matrices, n=4 |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
- |
|
|
20 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Non-persistent |
|
pH sensitive: DT₅₀ 28 days at pH 2, 16.9 days at pH 9, 2 days at pH 10, all at 20 °C |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
1068 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
620 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
10.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 1.70 |
Cyprinus carpio |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.1 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class II) |
- |
- |
|
620 |
Rat |
Moderate |
|
5000 |
Rat |
- |
|
0.37 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6,1 |
|
Health: H302 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2991 |
|
- |
|
- |
|
|
|
fenobucarb |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
fenobukarb |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |